C15H14Cl2FNO — CID 171271557
(1S,2R)-1-amino-1-(3,6-dichloro-2-fluorophenyl)-3-phenylpropan-2-ol (PubChem CID 171271557) has the molecular formula C15H14Cl2FNO and a molecular weight of 314.19 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3,6-dichloro-2-fluorophenyl)-3-phenylpropan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(3,6-dichloro-2-fluorophenyl)-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 171271557 |
| Molecular Formula | C15H14Cl2FNO |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (1S,2R)-1-amino-1-(3,6-dichloro-2-fluorophenyl)-3-phenylpropan-2-ol |
| SMILES | N[C@@H](c1c(Cl)ccc(Cl)c1F)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H14Cl2FNO/c16-10-6-7-11(17)14(18)13(10)15(19)12(20)8-9-4-2-1-3-5-9/h1-7,12,15,20H,8,19H2/t12-,15-/m1/s1 |
| InChIKey | BHMUDQCUJVHKPK-IUODEOHRSA-N |
| XLogP | 3.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|