C8H6Cl2F3N — CID 130707442
(1S)-1-(3,6-dichloro-2-fluorophenyl)-2,2-difluoroethanamine (PubChem CID 130707442) has the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. Its IUPAC name is (1S)-1-(3,6-dichloro-2-fluorophenyl)-2,2-difluoroethanamine.
| Compound Name | (1S)-1-(3,6-dichloro-2-fluorophenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130707442 |
| Molecular Formula | C8H6Cl2F3N |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | (1S)-1-(3,6-dichloro-2-fluorophenyl)-2,2-difluoroethanamine |
| SMILES | N[C@@H](c1c(Cl)ccc(Cl)c1F)C(F)F |
| InChI | InChI=1S/C8H6Cl2F3N/c9-3-1-2-4(10)6(11)5(3)7(14)8(12)13/h1-2,7-8H,14H2/t7-/m0/s1 |
| InChIKey | KQEWOUMNKMXODH-ZETCQYMHSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|