C8H7Cl2F2N — CID 130739555
(1R)-1-(2,6-dichlorophenyl)-2,2-difluoroethanamine (PubChem CID 130739555) has the molecular formula C8H7Cl2F2N and a molecular weight of 226.05 g/mol. Its IUPAC name is (1R)-1-(2,6-dichlorophenyl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(2,6-dichlorophenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130739555 |
| Molecular Formula | C8H7Cl2F2N |
| Molecular Weight | 226.05 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | (1R)-1-(2,6-dichlorophenyl)-2,2-difluoroethanamine |
| SMILES | N[C@H](c1c(Cl)cccc1Cl)C(F)F |
| InChI | InChI=1S/C8H7Cl2F2N/c9-4-2-1-3-5(10)6(4)7(13)8(11)12/h1-3,7-8H,13H2/t7-/m1/s1 |
| InChIKey | LARJQAJBXYLMFN-SSDOTTSWSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.05 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |