C9H9Cl2F2N — CID 103759791
3-(2,6-dichlorophenyl)-1,1-difluoropropan-2-amine (PubChem CID 103759791) has the molecular formula C9H9Cl2F2N and a molecular weight of 240.08 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1,1-difluoropropan-2-amine.
| Compound Name | 3-(2,6-dichlorophenyl)-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 103759791 |
| Molecular Formula | C9H9Cl2F2N |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1,1-difluoropropan-2-amine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)C(F)F |
| InChI | InChI=1S/C9H9Cl2F2N/c10-6-2-1-3-7(11)5(6)4-8(14)9(12)13/h1-3,8-9H,4,14H2 |
| InChIKey | GMOSDSLNBIYNJT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |