C14H11Cl2F2N — CID 62600681
2-(2,6-dichlorophenyl)-1-(3,4-difluorophenyl)ethanamine (PubChem CID 62600681) has the molecular formula C14H11Cl2F2N and a molecular weight of 302.15 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(3,4-difluorophenyl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(3,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 62600681 |
| Molecular Formula | C14H11Cl2F2N |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(3,4-difluorophenyl)ethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11Cl2F2N/c15-10-2-1-3-11(16)9(10)7-14(19)8-4-5-12(17)13(18)6-8/h1-6,14H,7,19H2 |
| InChIKey | AYXHMNMYPVODLP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |