C14H11Br2Cl2N — CID 107974218
1-(3,5-dibromophenyl)-2-(2,6-dichlorophenyl)ethanamine (PubChem CID 107974218) has the molecular formula C14H11Br2Cl2N and a molecular weight of 423.96 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-2-(2,6-dichlorophenyl)ethanamine.
| Compound Name | 1-(3,5-dibromophenyl)-2-(2,6-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 107974218 |
| Molecular Formula | C14H11Br2Cl2N |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 420.86 |
| IUPAC Name | 1-(3,5-dibromophenyl)-2-(2,6-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H11Br2Cl2N/c15-9-4-8(5-10(16)6-9)14(19)7-11-12(17)2-1-3-13(11)18/h1-6,14H,7,19H2 |
| InChIKey | OKPUCQKDJHOEBI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |