C12H11Cl2N3 — CID 55078463
2-(2,6-dichlorophenyl)-1-pyrimidin-5-ylethanamine (PubChem CID 55078463) has the molecular formula C12H11Cl2N3 and a molecular weight of 268.15 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-pyrimidin-5-ylethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-1-pyrimidin-5-ylethanamine |
|---|---|
| PubChem CID | 55078463 |
| Molecular Formula | C12H11Cl2N3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-pyrimidin-5-ylethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)c1cncnc1 |
| InChI | InChI=1S/C12H11Cl2N3/c13-10-2-1-3-11(14)9(10)4-12(15)8-5-16-7-17-6-8/h1-3,5-7,12H,4,15H2 |
| InChIKey | STGWCYPGJLMOAE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |