C8H11ClN2O — CID 55277698
3-chloro-2-[(1S)-1,2-diaminoethyl]phenol (PubChem CID 55277698) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 3-chloro-2-[(1S)-1,2-diaminoethyl]phenol.
| Compound Name | 3-chloro-2-[(1S)-1,2-diaminoethyl]phenol |
|---|---|
| PubChem CID | 55277698 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-chloro-2-[(1S)-1,2-diaminoethyl]phenol |
| SMILES | NC[C@@H](N)c1c(O)cccc1Cl |
| InChI | InChI=1S/C8H11ClN2O/c9-5-2-1-3-7(12)8(5)6(11)4-10/h1-3,6,12H,4,10-11H2/t6-/m1/s1 |
| InChIKey | LQCHPHLZSYPKMO-ZCFIWIBFSA-N |
| XLogP | 1.00 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|