C8H10BrClN2 — CID 131086535
(1S)-1-(2-bromo-6-chlorophenyl)ethane-1,2-diamine (PubChem CID 131086535) has the molecular formula C8H10BrClN2 and a molecular weight of 249.54 g/mol. Its IUPAC name is (1S)-1-(2-bromo-6-chlorophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-bromo-6-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 131086535 |
| Molecular Formula | C8H10BrClN2 |
| Molecular Weight | 249.54 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (1S)-1-(2-bromo-6-chlorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1c(Cl)cccc1Br |
| InChI | InChI=1S/C8H10BrClN2/c9-5-2-1-3-6(10)8(5)7(12)4-11/h1-3,7H,4,11-12H2/t7-/m1/s1 |
| InChIKey | QHEOBXLSEJVAOK-SSDOTTSWSA-N |
| XLogP | 2.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |