C8H10Br2N2 — CID 130043520
1-(2,3-dibromophenyl)ethane-1,2-diamine (PubChem CID 130043520) has the molecular formula C8H10Br2N2 and a molecular weight of 293.99 g/mol. Its IUPAC name is 1-(2,3-dibromophenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,3-dibromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130043520 |
| Molecular Formula | C8H10Br2N2 |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 1-(2,3-dibromophenyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1cccc(Br)c1Br |
| InChI | InChI=1S/C8H10Br2N2/c9-6-3-1-2-5(8(6)10)7(12)4-11/h1-3,7H,4,11-12H2 |
| InChIKey | JRYLHAFCKWTFSZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |