C8H9Br2NO — CID 54407818
(1R)-2-amino-1-(2,3-dibromophenyl)ethanol (PubChem CID 54407818) has the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. Its IUPAC name is (1R)-2-amino-1-(2,3-dibromophenyl)ethanol.
| Compound Name | (1R)-2-amino-1-(2,3-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 54407818 |
| Molecular Formula | C8H9Br2NO |
| Molecular Weight | 294.97 g/mol |
| Exact Mass | 292.91 |
| IUPAC Name | (1R)-2-amino-1-(2,3-dibromophenyl)ethanol |
| SMILES | NC[C@H](O)c1cccc(Br)c1Br |
| InChI | InChI=1S/C8H9Br2NO/c9-6-3-1-2-5(8(6)10)7(12)4-11/h1-3,7,12H,4,11H2/t7-/m0/s1 |
| InChIKey | VRZHFYUNUYGVGT-ZETCQYMHSA-N |
| XLogP | 2.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.97 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |