C8H9Cl3N2 — CID 130714145
(1R)-1-(2,3,6-trichlorophenyl)ethane-1,2-diamine (PubChem CID 130714145) has the molecular formula C8H9Cl3N2 and a molecular weight of 239.53 g/mol. Its IUPAC name is (1R)-1-(2,3,6-trichlorophenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(2,3,6-trichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130714145 |
| Molecular Formula | C8H9Cl3N2 |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | (1R)-1-(2,3,6-trichlorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H9Cl3N2/c9-4-1-2-5(10)8(11)7(4)6(13)3-12/h1-2,6H,3,12-13H2/t6-/m0/s1 |
| InChIKey | SHSOPKXVNJSBDX-LURJTMIESA-N |
| XLogP | 2.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|