C12H17Cl4N — CID 171232410
(1S)-4-methyl-1-(2,3,6-trichlorophenyl)pentan-1-amine;hydrochloride (PubChem CID 171232410) has the molecular formula C12H17Cl4N and a molecular weight of 317.09 g/mol. Its IUPAC name is (1S)-4-methyl-1-(2,3,6-trichlorophenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1S)-4-methyl-1-(2,3,6-trichlorophenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171232410 |
| Molecular Formula | C12H17Cl4N |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (1S)-4-methyl-1-(2,3,6-trichlorophenyl)pentan-1-amine;hydrochloride |
| SMILES | CC(C)CC[C@H](N)c1c(Cl)ccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C12H16Cl3N.ClH/c1-7(2)3-6-10(16)11-8(13)4-5-9(14)12(11)15;/h4-5,7,10H,3,6,16H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | CMHUHHVWJRUSMF-PPHPATTJSA-N |
| XLogP | 5.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|