C13H18Cl2FNO — CID 171265859
(1R,2S)-1-amino-1-(2,3-dichloro-6-fluorophenyl)-5-methylhexan-2-ol (PubChem CID 171265859) has the molecular formula C13H18Cl2FNO and a molecular weight of 294.20 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,3-dichloro-6-fluorophenyl)-5-methylhexan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,3-dichloro-6-fluorophenyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171265859 |
| Molecular Formula | C13H18Cl2FNO |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,3-dichloro-6-fluorophenyl)-5-methylhexan-2-ol |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2FNO/c1-7(2)3-6-10(18)13(17)11-9(16)5-4-8(14)12(11)15/h4-5,7,10,13,18H,3,6,17H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | TZYZQSUHYZFPGV-GWCFXTLKSA-N |
| XLogP | 3.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|