C13H18ClF2NO — CID 171269644
(1S,2R)-1-amino-1-(2-chloro-3,6-difluorophenyl)-5-methylhexan-2-ol (PubChem CID 171269644) has the molecular formula C13H18ClF2NO and a molecular weight of 277.74 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-chloro-3,6-difluorophenyl)-5-methylhexan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-chloro-3,6-difluorophenyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171269644 |
| Molecular Formula | C13H18ClF2NO |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-chloro-3,6-difluorophenyl)-5-methylhexan-2-ol |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C13H18ClF2NO/c1-7(2)3-6-10(18)13(17)11-8(15)4-5-9(16)12(11)14/h4-5,7,10,13,18H,3,6,17H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | HKBNAKHMEKEFQC-ZWNOBZJWSA-N |
| XLogP | 3.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|