C12H16Cl2FN — CID 171215609
(1R)-1-(2,3-dichloro-6-fluorophenyl)-4-methylpentan-1-amine (PubChem CID 171215609) has the molecular formula C12H16Cl2FN and a molecular weight of 264.17 g/mol. Its IUPAC name is (1R)-1-(2,3-dichloro-6-fluorophenyl)-4-methylpentan-1-amine.
| Compound Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 171215609 |
| Molecular Formula | C12H16Cl2FN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)-4-methylpentan-1-amine |
| SMILES | CC(C)CC[C@@H](N)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2FN/c1-7(2)3-6-10(16)11-9(15)5-4-8(13)12(11)14/h4-5,7,10H,3,6,16H2,1-2H3/t10-/m1/s1 |
| InChIKey | VSUZBPJWODVRDF-SNVBAGLBSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|