C10H10Cl2FN — CID 130701468
(1R)-1-(2,3-dichloro-6-fluorophenyl)but-3-en-1-amine (PubChem CID 130701468) has the molecular formula C10H10Cl2FN and a molecular weight of 234.10 g/mol. Its IUPAC name is (1R)-1-(2,3-dichloro-6-fluorophenyl)but-3-en-1-amine.
| Compound Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 130701468 |
| Molecular Formula | C10H10Cl2FN |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)but-3-en-1-amine |
| SMILES | C=CC[C@@H](N)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2FN/c1-2-3-8(14)9-7(13)5-4-6(11)10(9)12/h2,4-5,8H,1,3,14H2/t8-/m1/s1 |
| InChIKey | PPYYUFNAVRBJDP-MRVPVSSYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|