C8H8Cl2FNO — CID 130709750
(2S)-2-amino-2-(2,3-dichloro-6-fluorophenyl)ethanol (PubChem CID 130709750) has the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3-dichloro-6-fluorophenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(2,3-dichloro-6-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 130709750 |
| Molecular Formula | C8H8Cl2FNO |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | (2S)-2-amino-2-(2,3-dichloro-6-fluorophenyl)ethanol |
| SMILES | N[C@H](CO)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2FNO/c9-4-1-2-5(11)7(8(4)10)6(12)3-13/h1-2,6,13H,3,12H2/t6-/m1/s1 |
| InChIKey | MBYGNROLSWMJSC-ZCFIWIBFSA-N |
| XLogP | 2.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|