C8H7ClF3N — CID 124707711
(1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethanamine (PubChem CID 124707711) has the molecular formula C8H7ClF3N and a molecular weight of 209.60 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethanamine.
| Compound Name | (1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 124707711 |
| Molecular Formula | C8H7ClF3N |
| Molecular Weight | 209.60 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | (1S)-1-(2-chloro-3,6-difluorophenyl)-2-fluoroethanamine |
| SMILES | N[C@H](CF)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C8H7ClF3N/c9-8-5(12)2-1-4(11)7(8)6(13)3-10/h1-2,6H,3,13H2/t6-/m1/s1 |
| InChIKey | OKQACCYSNBFCDM-ZCFIWIBFSA-N |
| XLogP | 2.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|