C10H10Cl2F5N — CID 171228945
(1S)-1-(2-chloro-3,6-difluorophenyl)-4,4,4-trifluorobutan-1-amine;hydrochloride (PubChem CID 171228945) has the molecular formula C10H10Cl2F5N and a molecular weight of 310.09 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,6-difluorophenyl)-4,4,4-trifluorobutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-chloro-3,6-difluorophenyl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228945 |
| Molecular Formula | C10H10Cl2F5N |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | (1S)-1-(2-chloro-3,6-difluorophenyl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(F)(F)F)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C10H9ClF5N.ClH/c11-9-6(13)2-1-5(12)8(9)7(17)3-4-10(14,15)16;/h1-2,7H,3-4,17H2;1H/t7-;/m0./s1 |
| InChIKey | KKTMPNNPCIBATB-FJXQXJEOSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|