C10H13Cl2F3N2 — CID 171233845
2-[(1S)-1-amino-4,4,4-trifluorobutyl]-4-chloroaniline;hydrochloride (PubChem CID 171233845) has the molecular formula C10H13Cl2F3N2 and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-4-chloroaniline;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-4-chloroaniline;hydrochloride |
|---|---|
| PubChem CID | 171233845 |
| Molecular Formula | C10H13Cl2F3N2 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[(1S)-1-amino-4,4,4-trifluorobutyl]-4-chloroaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(Cl)cc1[C@@H](N)CCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2.ClH/c11-6-1-2-8(15)7(5-6)9(16)3-4-10(12,13)14;/h1-2,5,9H,3-4,15-16H2;1H/t9-;/m0./s1 |
| InChIKey | HWHBMWMIPXIHGQ-FVGYRXGTSA-N |
| XLogP | 3.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|