C9H11ClF2N2 — CID 171313952
2-[(1R)-1-amino-3,3-difluoropropyl]-4-chloroaniline (PubChem CID 171313952) has the molecular formula C9H11ClF2N2 and a molecular weight of 220.65 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3,3-difluoropropyl]-4-chloroaniline.
| Compound Name | 2-[(1R)-1-amino-3,3-difluoropropyl]-4-chloroaniline |
|---|---|
| PubChem CID | 171313952 |
| Molecular Formula | C9H11ClF2N2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-[(1R)-1-amino-3,3-difluoropropyl]-4-chloroaniline |
| SMILES | Nc1ccc(Cl)cc1[C@H](N)CC(F)F |
| InChI | InChI=1S/C9H11ClF2N2/c10-5-1-2-7(13)6(3-5)8(14)4-9(11)12/h1-3,8-9H,4,13-14H2/t8-/m1/s1 |
| InChIKey | MRVSPDFNFVUVTH-MRVPVSSYSA-N |
| XLogP | 2.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|