C9H9Cl2F2N — CID 131456103
(1R)-1-(2,4-dichlorophenyl)-3,3-difluoropropan-1-amine (PubChem CID 131456103) has the molecular formula C9H9Cl2F2N and a molecular weight of 240.08 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 131456103 |
| Molecular Formula | C9H9Cl2F2N |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)-3,3-difluoropropan-1-amine |
| SMILES | N[C@H](CC(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2F2N/c10-5-1-2-6(7(11)3-5)8(14)4-9(12)13/h1-3,8-9H,4,14H2/t8-/m1/s1 |
| InChIKey | KQLQYZANYCANJT-MRVPVSSYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |