C9H13Cl3N2 — CID 171212529
(1R)-1-(2,4-dichlorophenyl)propane-1,3-diamine;hydrochloride (PubChem CID 171212529) has the molecular formula C9H13Cl3N2 and a molecular weight of 255.58 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171212529 |
| Molecular Formula | C9H13Cl3N2 |
| Molecular Weight | 255.58 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCC[C@@H](N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N2.ClH/c10-6-1-2-7(8(11)5-6)9(13)3-4-12;/h1-2,5,9H,3-4,12-13H2;1H/t9-;/m1./s1 |
| InChIKey | HIQKFTDYDLDWFT-SBSPUUFOSA-N |
| XLogP | 2.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |