C12H13Cl2N — CID 15527266
1-(2,4-dichlorophenyl)hexa-4,5-dien-1-amine (PubChem CID 15527266) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)hexa-4,5-dien-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)hexa-4,5-dien-1-amine |
|---|---|
| PubChem CID | 15527266 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)hexa-4,5-dien-1-amine |
| SMILES | C=C=CCCC(N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N/c1-2-3-4-5-12(15)10-7-6-9(13)8-11(10)14/h3,6-8,12H,1,4-5,15H2 |
| InChIKey | ITQQBLVHMMFGPJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |