C12H16Cl2N2O — CID 61271207
6-amino-6-(2,4-dichlorophenyl)hexanamide (PubChem CID 61271207) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 6-amino-6-(2,4-dichlorophenyl)hexanamide.
| Compound Name | 6-amino-6-(2,4-dichlorophenyl)hexanamide |
|---|---|
| PubChem CID | 61271207 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 6-amino-6-(2,4-dichlorophenyl)hexanamide |
| SMILES | NC(=O)CCCCC(N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O/c13-8-5-6-9(10(14)7-8)11(15)3-1-2-4-12(16)17/h5-7,11H,1-4,15H2,(H2,16,17) |
| InChIKey | HLOGKOUKUZNOME-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|