C10H13Cl2N — CID 95914063
(3R)-3-(2,4-dichlorophenyl)butan-1-amine (PubChem CID 95914063) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenyl)butan-1-amine.
| Compound Name | (3R)-3-(2,4-dichlorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 95914063 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenyl)butan-1-amine |
| SMILES | C[C@H](CCN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2N/c1-7(4-5-13)9-3-2-8(11)6-10(9)12/h2-3,6-7H,4-5,13H2,1H3/t7-/m1/s1 |
| InChIKey | NJYGEIPMNNESGU-SSDOTTSWSA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |