C12H18ClN — CID 84782148
3-(4-chloro-2,5-dimethylphenyl)butan-1-amine (PubChem CID 84782148) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethylphenyl)butan-1-amine.
| Compound Name | 3-(4-chloro-2,5-dimethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 84782148 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-(4-chloro-2,5-dimethylphenyl)butan-1-amine |
| SMILES | Cc1cc(C(C)CCN)c(C)cc1Cl |
| InChI | InChI=1S/C12H18ClN/c1-8(4-5-14)11-6-10(3)12(13)7-9(11)2/h6-8H,4-5,14H2,1-3H3 |
| InChIKey | JOHLPRACWRTOJE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |