C11H14ClF2N — CID 117339667
3-(3-chloro-2,6-difluoro-5-methylphenyl)butan-1-amine (PubChem CID 117339667) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluoro-5-methylphenyl)butan-1-amine.
| Compound Name | 3-(3-chloro-2,6-difluoro-5-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117339667 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-(3-chloro-2,6-difluoro-5-methylphenyl)butan-1-amine |
| SMILES | Cc1cc(Cl)c(F)c(C(C)CCN)c1F |
| InChI | InChI=1S/C11H14ClF2N/c1-6(3-4-15)9-10(13)7(2)5-8(12)11(9)14/h5-6H,3-4,15H2,1-2H3 |
| InChIKey | IZIJJRKULUWQOK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|