C10H12ClF2N — CID 130512226
3-(6-chloro-2,3-difluorophenyl)butan-1-amine (PubChem CID 130512226) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is 3-(6-chloro-2,3-difluorophenyl)butan-1-amine.
| Compound Name | 3-(6-chloro-2,3-difluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 130512226 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 3-(6-chloro-2,3-difluorophenyl)butan-1-amine |
| SMILES | CC(CCN)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C10H12ClF2N/c1-6(4-5-14)9-7(11)2-3-8(12)10(9)13/h2-3,6H,4-5,14H2,1H3 |
| InChIKey | QXNFRWSCEKNRNV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|