C8H8ClF2N — CID 130512093
1-(6-chloro-2,3-difluorophenyl)ethanamine (PubChem CID 130512093) has the molecular formula C8H8ClF2N and a molecular weight of 191.61 g/mol. Its IUPAC name is 1-(6-chloro-2,3-difluorophenyl)ethanamine.
| Compound Name | 1-(6-chloro-2,3-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 130512093 |
| Molecular Formula | C8H8ClF2N |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 1-(6-chloro-2,3-difluorophenyl)ethanamine |
| SMILES | CC(N)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C8H8ClF2N/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-4H,12H2,1H3 |
| InChIKey | SZLKLWCAOLJILB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|