C8H9Cl3FN — CID 171215578
(1R)-1-(2,3-dichloro-6-fluorophenyl)ethanamine;hydrochloride (PubChem CID 171215578) has the molecular formula C8H9Cl3FN and a molecular weight of 244.52 g/mol. Its IUPAC name is (1R)-1-(2,3-dichloro-6-fluorophenyl)ethanamine;hydrochloride.
| Compound Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171215578 |
| Molecular Formula | C8H9Cl3FN |
| Molecular Weight | 244.52 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | (1R)-1-(2,3-dichloro-6-fluorophenyl)ethanamine;hydrochloride |
| SMILES | C[C@@H](N)c1c(F)ccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C8H8Cl2FN.ClH/c1-4(12)7-6(11)3-2-5(9)8(7)10;/h2-4H,12H2,1H3;1H/t4-;/m1./s1 |
| InChIKey | GINCUUZZSVQZNI-PGMHMLKASA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|