C11H14Cl2FNO — CID 131566185
(3R)-3-amino-3-(2,3-dichloro-6-fluorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 131566185) has the molecular formula C11H14Cl2FNO and a molecular weight of 266.14 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,3-dichloro-6-fluorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | (3R)-3-amino-3-(2,3-dichloro-6-fluorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 131566185 |
| Molecular Formula | C11H14Cl2FNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (3R)-3-amino-3-(2,3-dichloro-6-fluorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)[C@@H](N)c1c(F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2FNO/c1-11(2,5-16)10(15)8-7(14)4-3-6(12)9(8)13/h3-4,10,16H,5,15H2,1-2H3/t10-/m0/s1 |
| InChIKey | BAMHRGFRQLAOGP-JTQLQIEISA-N |
| XLogP | 3.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|