C11H15BrClNO2 — CID 131491216
2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-bromo-6-chlorophenol (PubChem CID 131491216) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-bromo-6-chlorophenol.
| Compound Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-bromo-6-chlorophenol |
|---|---|
| PubChem CID | 131491216 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3-bromo-6-chlorophenol |
| SMILES | CC(C)(CO)[C@H](N)c1c(Br)ccc(Cl)c1O |
| InChI | InChI=1S/C11H15BrClNO2/c1-11(2,5-15)10(14)8-6(12)3-4-7(13)9(8)16/h3-4,10,15-16H,5,14H2,1-2H3/t10-/m1/s1 |
| InChIKey | BMUHYHGVMXXHLB-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|