C11H15Cl2NO2 — CID 131582381
2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dichlorophenol (PubChem CID 131582381) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dichlorophenol.
| Compound Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dichlorophenol |
|---|---|
| PubChem CID | 131582381 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-3,5-dichlorophenol |
| SMILES | CC(C)(CO)[C@@H](N)c1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c1-11(2,5-15)10(14)9-7(13)3-6(12)4-8(9)16/h3-4,10,15-16H,5,14H2,1-2H3/t10-/m0/s1 |
| InChIKey | KRNLICVVMXINBT-JTQLQIEISA-N |
| XLogP | 2.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|