C11H16ClNO2 — CID 131387812
4-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-chlorophenol (PubChem CID 131387812) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-chlorophenol.
| Compound Name | 4-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-chlorophenol |
|---|---|
| PubChem CID | 131387812 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-2-chlorophenol |
| SMILES | CC(C)(CO)[C@H](N)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO2/c1-11(2,6-14)10(13)7-3-4-9(15)8(12)5-7/h3-5,10,14-15H,6,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | HOWOXWUBZYWPIB-SNVBAGLBSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |