C11H15Cl4NO — CID 171243899
(3S)-3-amino-2,2-dimethyl-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride (PubChem CID 171243899) has the molecular formula C11H15Cl4NO and a molecular weight of 319.06 g/mol. Its IUPAC name is (3S)-3-amino-2,2-dimethyl-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride.
| Compound Name | (3S)-3-amino-2,2-dimethyl-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171243899 |
| Molecular Formula | C11H15Cl4NO |
| Molecular Weight | 319.06 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | (3S)-3-amino-2,2-dimethyl-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)[C@H](N)c1c(Cl)ccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C11H14Cl3NO.ClH/c1-11(2,5-16)10(15)8-6(12)3-4-7(13)9(8)14;/h3-4,10,16H,5,15H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | UYODSVMLHNGUEK-HNCPQSOCSA-N |
| XLogP | 4.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|