C9H11Cl4NO — CID 170874474
3-amino-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride (PubChem CID 170874474) has the molecular formula C9H11Cl4NO and a molecular weight of 291.00 g/mol. Its IUPAC name is 3-amino-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170874474 |
| Molecular Formula | C9H11Cl4NO |
| Molecular Weight | 291.00 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 3-amino-3-(2,3,6-trichlorophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CCO)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl3NO.ClH/c10-5-1-2-6(11)9(12)8(5)7(13)3-4-14;/h1-2,7,14H,3-4,13H2;1H |
| InChIKey | HSSJYTWFENUXJC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.00 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|