C9H8Cl3F2NO — CID 131257946
(3S)-3-amino-2,2-difluoro-3-(2,3,6-trichlorophenyl)propan-1-ol (PubChem CID 131257946) has the molecular formula C9H8Cl3F2NO and a molecular weight of 290.52 g/mol. Its IUPAC name is (3S)-3-amino-2,2-difluoro-3-(2,3,6-trichlorophenyl)propan-1-ol.
| Compound Name | (3S)-3-amino-2,2-difluoro-3-(2,3,6-trichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 131257946 |
| Molecular Formula | C9H8Cl3F2NO |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | (3S)-3-amino-2,2-difluoro-3-(2,3,6-trichlorophenyl)propan-1-ol |
| SMILES | N[C@@H](c1c(Cl)ccc(Cl)c1Cl)C(F)(F)CO |
| InChI | InChI=1S/C9H8Cl3F2NO/c10-4-1-2-5(11)7(12)6(4)8(15)9(13,14)3-16/h1-2,8,16H,3,15H2/t8-/m0/s1 |
| InChIKey | MBSAADZMUOHSFF-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|