C9H6F7NO — CID 171243144
(3R)-3-amino-2,2-difluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol (PubChem CID 171243144) has the molecular formula C9H6F7NO and a molecular weight of 277.14 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 171243144 |
| Molecular Formula | C9H6F7NO |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol |
| SMILES | N[C@H](c1c(F)c(F)c(F)c(F)c1F)C(F)(F)CO |
| InChI | InChI=1S/C9H6F7NO/c10-3-2(8(17)9(15,16)1-18)4(11)6(13)7(14)5(3)12/h8,18H,1,17H2/t8-/m1/s1 |
| InChIKey | OMMCJIGBPFRQCL-MRVPVSSYSA-N |
| XLogP | 2.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|