C9H8BrF4NO — CID 131392243
(3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)-2,2-difluoropropan-1-ol (PubChem CID 131392243) has the molecular formula C9H8BrF4NO and a molecular weight of 302.06 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)-2,2-difluoropropan-1-ol.
| Compound Name | (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 131392243 |
| Molecular Formula | C9H8BrF4NO |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | (3R)-3-amino-3-(3-bromo-2,6-difluorophenyl)-2,2-difluoropropan-1-ol |
| SMILES | N[C@H](c1c(F)ccc(Br)c1F)C(F)(F)CO |
| InChI | InChI=1S/C9H8BrF4NO/c10-4-1-2-5(11)6(7(4)12)8(15)9(13,14)3-16/h1-2,8,16H,3,15H2/t8-/m1/s1 |
| InChIKey | QCYGWGDHDCICHX-MRVPVSSYSA-N |
| XLogP | 2.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|