C14H21BrF2N2 — CID 106942739
1-(3-bromo-2,6-difluorophenyl)-2-ethyl-2-N,2-N-dimethylbutane-1,2-diamine (PubChem CID 106942739) has the molecular formula C14H21BrF2N2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-ethyl-2-N,2-N-dimethylbutane-1,2-diamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethyl-2-N,2-N-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 106942739 |
| Molecular Formula | C14H21BrF2N2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-ethyl-2-N,2-N-dimethylbutane-1,2-diamine |
| SMILES | CCC(CC)(C(N)c1c(F)ccc(Br)c1F)N(C)C |
| InChI | InChI=1S/C14H21BrF2N2/c1-5-14(6-2,19(3)4)13(18)11-10(16)8-7-9(15)12(11)17/h7-8,13H,5-6,18H2,1-4H3 |
| InChIKey | ADABNJTVDPCTDI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|