C15H24BrF2N3 — CID 106945368
1-(3-bromo-2,6-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine (PubChem CID 106945368) has the molecular formula C15H24BrF2N3 and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 106945368 |
| Molecular Formula | C15H24BrF2N3 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylbutan-2-amine |
| SMILES | CCN(CC)C(C)(CC)C(NN)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H24BrF2N3/c1-5-15(4,21(6-2)7-3)14(20-19)12-11(17)9-8-10(16)13(12)18/h8-9,14,20H,5-7,19H2,1-4H3 |
| InChIKey | OBLUHLRKUZLGFQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|