C10H10BrF5N2 — CID 106945388
[1-(3-bromo-2,6-difluorophenyl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 106945388) has the molecular formula C10H10BrF5N2 and a molecular weight of 333.10 g/mol. Its IUPAC name is [1-(3-bromo-2,6-difluorophenyl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(3-bromo-2,6-difluorophenyl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 106945388 |
| Molecular Formula | C10H10BrF5N2 |
| Molecular Weight | 333.10 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | [1-(3-bromo-2,6-difluorophenyl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H10BrF5N2/c11-5-1-2-6(12)8(9(5)13)7(18-17)3-4-10(14,15)16/h1-2,7,18H,3-4,17H2 |
| InChIKey | DHTHEZPXBGZQRP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|