C10H11Cl2F3N2 — CID 105313893
[1-(2,6-dichlorophenyl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105313893) has the molecular formula C10H11Cl2F3N2 and a molecular weight of 287.11 g/mol. Its IUPAC name is [1-(2,6-dichlorophenyl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(2,6-dichlorophenyl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105313893 |
| Molecular Formula | C10H11Cl2F3N2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | [1-(2,6-dichlorophenyl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H11Cl2F3N2/c11-6-2-1-3-7(12)9(6)8(17-16)4-5-10(13,14)15/h1-3,8,17H,4-5,16H2 |
| InChIKey | MXLZOLBUIMMYDZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|