C11H13ClF4N2 — CID 107997242
[1-(4-chloro-3-fluorophenyl)-5,5,5-trifluoropentyl]hydrazine (PubChem CID 107997242) has the molecular formula C11H13ClF4N2 and a molecular weight of 284.68 g/mol. Its IUPAC name is [1-(4-chloro-3-fluorophenyl)-5,5,5-trifluoropentyl]hydrazine.
| Compound Name | [1-(4-chloro-3-fluorophenyl)-5,5,5-trifluoropentyl]hydrazine |
|---|---|
| PubChem CID | 107997242 |
| Molecular Formula | C11H13ClF4N2 |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | [1-(4-chloro-3-fluorophenyl)-5,5,5-trifluoropentyl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H13ClF4N2/c12-8-4-3-7(6-9(8)13)10(18-17)2-1-5-11(14,15)16/h3-4,6,10,18H,1-2,5,17H2 |
| InChIKey | VUQXAHXHJDMVHI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|