C13H20ClFN2 — CID 105218176
[1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentyl]hydrazine (PubChem CID 105218176) has the molecular formula C13H20ClFN2 and a molecular weight of 258.77 g/mol. Its IUPAC name is [1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentyl]hydrazine.
| Compound Name | [1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentyl]hydrazine |
|---|---|
| PubChem CID | 105218176 |
| Molecular Formula | C13H20ClFN2 |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1-(3-chloro-4-fluorophenyl)-4,4-dimethylpentyl]hydrazine |
| SMILES | CC(C)(C)CCC(NN)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClFN2/c1-13(2,3)7-6-12(17-16)9-4-5-11(15)10(14)8-9/h4-5,8,12,17H,6-7,16H2,1-3H3 |
| InChIKey | VHYCNFUEIUMMGA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|