C11H14ClF3N2 — CID 105313900
[1-(3-chloro-4-methylphenyl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105313900) has the molecular formula C11H14ClF3N2 and a molecular weight of 266.69 g/mol. Its IUPAC name is [1-(3-chloro-4-methylphenyl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(3-chloro-4-methylphenyl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105313900 |
| Molecular Formula | C11H14ClF3N2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [1-(3-chloro-4-methylphenyl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | Cc1ccc(C(CCC(F)(F)F)NN)cc1Cl |
| InChI | InChI=1S/C11H14ClF3N2/c1-7-2-3-8(6-9(7)12)10(17-16)4-5-11(13,14)15/h2-3,6,10,17H,4-5,16H2,1H3 |
| InChIKey | FXZJOLLAOPRNKS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|