C10H13ClF3N3 — CID 105252699
[1-(2-chloro-4-pyridinyl)-5,5,5-trifluoropentyl]hydrazine (PubChem CID 105252699) has the molecular formula C10H13ClF3N3 and a molecular weight of 267.68 g/mol. Its IUPAC name is [1-(2-chloro-4-pyridinyl)-5,5,5-trifluoropentyl]hydrazine.
| Compound Name | [1-(2-chloro-4-pyridinyl)-5,5,5-trifluoropentyl]hydrazine |
|---|---|
| PubChem CID | 105252699 |
| Molecular Formula | C10H13ClF3N3 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [1-(2-chloro-4-pyridinyl)-5,5,5-trifluoropentyl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H13ClF3N3/c11-9-6-7(3-5-16-9)8(17-15)2-1-4-10(12,13)14/h3,5-6,8,17H,1-2,4,15H2 |
| InChIKey | ZCCKODPEKFKMSI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|