C12H12ClF3N2O — CID 105249039
[1-(7-chloro-1-benzofuran-2-yl)-4,4,4-trifluorobutyl]hydrazine (PubChem CID 105249039) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is [1-(7-chloro-1-benzofuran-2-yl)-4,4,4-trifluorobutyl]hydrazine.
| Compound Name | [1-(7-chloro-1-benzofuran-2-yl)-4,4,4-trifluorobutyl]hydrazine |
|---|---|
| PubChem CID | 105249039 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [1-(7-chloro-1-benzofuran-2-yl)-4,4,4-trifluorobutyl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C12H12ClF3N2O/c13-8-3-1-2-7-6-10(19-11(7)8)9(18-17)4-5-12(14,15)16/h1-3,6,9,18H,4-5,17H2 |
| InChIKey | XRYLURHOGVSZLB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|